|
CAS#: 640-49-3 Product: beta-Apocarotenal No suppilers available for the product. |
| Name | beta-Apocarotenal |
|---|---|
| Synonyms | 10'-Apo-Beta,Psi-Carotenal |
| Molecular Structure | ![]() |
| Molecular Formula | C27H36O |
| Molecular Weight | 376.58 |
| CAS Registry Number | 640-49-3 |
| SMILES | CC1=C(/C=C/C(=C/C=C/C(=C/C=C/C=C(/C=C/C=O)C)C)C)C(CCC1)(C)C |
| InChI | 1S/C27H36O/c1-22(12-7-8-13-23(2)16-11-21-28)14-9-15-24(3)18-19-26-25(4)17-10-20-27(26,5)6/h7-9,11-16,18-19,21H,10,17,20H2,1-6H3/b8-7+,14-9+,16-11+,19-18+,22-12+,23-13+,24-15+ |
| InChIKey | PJEHRCCPERVGEC-FLHUAPOTSA-N |
| Density | 0.951g/cm3 (Cal.) |
|---|---|
| Boiling point | 534.588°C at 760 mmHg (Cal.) |
| Flash point | 258.413°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for beta-Apocarotenal |