|
CAS#: 64011-55-8 Product: N-Methyl-4-(4-Fluorophenyl)-3-Cyclohexen-1-Amine No suppilers available for the product. |
| Name | N-Methyl-4-(4-Fluorophenyl)-3-Cyclohexen-1-Amine |
|---|---|
| Synonyms | 4-(4-Fluorophenyl)-N-Methyl-Cyclohex-3-En-1-Amine; 4-(4-Fluorophenyl)-N-Methyl-1-Cyclohex-3-Enamine; [4-(4-Fluorophenyl)-1-Cyclohex-3-Enyl]-Methyl-Amine |
| Molecular Structure | ![]() |
| Molecular Formula | C13H16FN |
| Molecular Weight | 205.27 |
| CAS Registry Number | 64011-55-8 |
| SMILES | C2=C(C1=CCC(NC)CC1)C=CC(=C2)F |
| InChI | 1S/C13H16FN/c1-15-13-8-4-11(5-9-13)10-2-6-12(14)7-3-10/h2-4,6-7,13,15H,5,8-9H2,1H3 |
| InChIKey | LDJJKBNMNLNRLP-UHFFFAOYSA-N |
| Density | 1.066g/cm3 (Cal.) |
|---|---|
| Boiling point | 289.418°C at 760 mmHg (Cal.) |
| Flash point | 128.835°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-Methyl-4-(4-Fluorophenyl)-3-Cyclohexen-1-Amine |