|
CAS#: 64024-05-1 Product: (alphas)-alpha-Amino-1-Benzyl-2-Methyl-1H-Indole-3-Propionic Acid No suppilers available for the product. |
| Name | (alphas)-alpha-Amino-1-Benzyl-2-Methyl-1H-Indole-3-Propionic Acid |
|---|---|
| Synonyms | 2-Amino-3-[2-Methyl-1-(Phenylmethyl)-3-Indolyl]Propanoic Acid; 2-Amino-3-[1-(Benzyl)-2-Methyl-Indol-3-Yl]Propionic Acid; Brn 3999156 |
| Molecular Structure | ![]() |
| Molecular Formula | C19H20N2O2 |
| Molecular Weight | 308.38 |
| CAS Registry Number | 64024-05-1 |
| SMILES | C1=CC=CC2=C1[N](C(=C2CC(C(=O)O)N)C)CC3=CC=CC=C3 |
| InChI | 1S/C19H20N2O2/c1-13-16(11-17(20)19(22)23)15-9-5-6-10-18(15)21(13)12-14-7-3-2-4-8-14/h2-10,17H,11-12,20H2,1H3,(H,22,23) |
| InChIKey | SOWYPVBHAZDFPZ-UHFFFAOYSA-N |
| Density | 1.213g/cm3 (Cal.) |
|---|---|
| Boiling point | 543.763°C at 760 mmHg (Cal.) |
| Flash point | 282.658°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (alphas)-alpha-Amino-1-Benzyl-2-Methyl-1H-Indole-3-Propionic Acid |