|
CAS#: 64037-56-5 Product: 2,5-Dimethyl-2-hepten-6-yl acetate No suppilers available for the product. |
| Name | 2,5-Dimethyl-2-hepten-6-yl acetate |
|---|---|
| Synonyms | N,N-Bis(2-Chloroethyl)-2-Methyl-Propan-1-Amine Hydrochloride; Bis(2-Chloroethyl)-Isobutyl-Amine Hydrochloride; Diethylamine, N-Sec-Butyl-2,2'-Dichloro-, Hydrochloride |
| Molecular Structure | ![]() |
| Molecular Formula | C8H18Cl3N |
| Molecular Weight | 234.60 |
| CAS Registry Number | 64037-56-5 |
| SMILES | [H+].C(N(CCCl)CCCl)C(C)C.[Cl-] |
| InChI | 1S/C8H17Cl2N.ClH/c1-8(2)7-11(5-3-9)6-4-10;/h8H,3-7H2,1-2H3;1H |
| InChIKey | HMNHFUHYPNQIMA-UHFFFAOYSA-N |
| Boiling point | 177.2°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 60.9°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,5-Dimethyl-2-hepten-6-yl acetate |