|
CAS#: 64038-25-1 Product: 5-Ethyl-5-phenyl-2-thiobarbituric acid sodium salt No suppilers available for the product. |
| Name | 5-Ethyl-5-phenyl-2-thiobarbituric acid sodium salt |
|---|---|
| Synonyms | Sodium 5-Ethyl-6-Oxo-5-Phenyl-2-Sulfanylidenepyrimidin-4-Olate; Sodium 5-Ethyl-5-Phenyl-2-Thioxo-Hexahydropyrimidin-3-Ide-4,6-Dione; Sodium 5-Ethyl-6-Oxo-5-Phenyl-2-Thioxo-Pyrimidin-4-Olate |
| Molecular Structure | ![]() |
| Molecular Formula | C12H11N2NaO2S |
| Molecular Weight | 270.28 |
| CAS Registry Number | 64038-25-1 |
| SMILES | C2=C(C1(C(=O)[N-]C(=S)NC1=O)CC)C=CC=C2.[Na+] |
| InChI | 1S/C12H12N2O2S.Na/c1-2-12(8-6-4-3-5-7-8)9(15)13-11(17)14-10(12)16;/h3-7H,2H2,1H3,(H2,13,14,15,16,17);/q;+1/p-1 |
| InChIKey | SNCDPCFJYKYRHM-UHFFFAOYSA-M |
| Market Analysis Reports |
| List of Reports Available for 5-Ethyl-5-phenyl-2-thiobarbituric acid sodium salt |