|
CAS#: 64038-71-7 Product: 4,4-Dimethyl-1-Phenylimidazolidine No suppilers available for the product. |
| Name | 4,4-Dimethyl-1-Phenylimidazolidine |
|---|---|
| Synonyms | 4,4-Dimethyl-1-Phenyl-Imidazolidine; 1-Phenyl-4,4-Dimethylimidazolidine; 4-23-00-00402 (Beilstein Handbook Reference) |
| Molecular Structure | ![]() |
| Molecular Formula | C11H16N2 |
| Molecular Weight | 176.26 |
| CAS Registry Number | 64038-71-7 |
| SMILES | C2=C(N1CNC(C1)(C)C)C=CC=C2 |
| InChI | 1S/C11H16N2/c1-11(2)8-13(9-12-11)10-6-4-3-5-7-10/h3-7,12H,8-9H2,1-2H3 |
| InChIKey | YWGWWSMYYQYOQE-UHFFFAOYSA-N |
| Density | 0.988g/cm3 (Cal.) |
|---|---|
| Boiling point | 272.861°C at 760 mmHg (Cal.) |
| Flash point | 116.172°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,4-Dimethyl-1-Phenylimidazolidine |