|
CAS#: 64039-88-9 Product: Nicafenine No suppilers available for the product. |
| Name | Nicafenine |
|---|---|
| Synonyms | 2-(Pyridine-3-Carbonylamino)Ethyl 2-[(7-Chloro-4-Quinolyl)Amino]Benzoate; 2-[(7-Chloro-4-Quinolyl)Amino]Benzoic Acid 2-[[Oxo-(3-Pyridyl)Methyl]Amino]Ethyl Ester; 2-[(7-Chloro-4-Quinolyl)Amino]Benzoic Acid 2-(Pyridine-3-Carbonylamino)Ethyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C24H19ClN4O3 |
| Molecular Weight | 446.89 |
| CAS Registry Number | 64039-88-9 |
| SMILES | C1=CC(=CC2=NC=CC(=C12)NC4=C(C(OCCNC(C3=CN=CC=C3)=O)=O)C=CC=C4)Cl |
| InChI | 1S/C24H19ClN4O3/c25-17-7-8-18-21(9-11-27-22(18)14-17)29-20-6-2-1-5-19(20)24(31)32-13-12-28-23(30)16-4-3-10-26-15-16/h1-11,14-15H,12-13H2,(H,27,29)(H,28,30) |
| InChIKey | XHMFPDMOPBXSDM-UHFFFAOYSA-N |
| Density | 1.366g/cm3 (Cal.) |
|---|---|
| Boiling point | 702.576°C at 760 mmHg (Cal.) |
| Flash point | 378.704°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Nicafenine |