|
CAS#: 64046-75-9 Product: Bis(2-Chlorovinyl)Phenylarsine No suppilers available for the product. |
| Name | Bis(2-Chlorovinyl)Phenylarsine |
|---|---|
| Synonyms | Bis[(E)-2-Chlorovinyl]-Phenyl-Arsane; Bis[(E)-2-Chlorovinyl]-Phenylarsane; Bis[(E)-2-Chloroethenyl]-Phenyl-Arsane |
| Molecular Structure | ![]() |
| Molecular Formula | C10H9AsCl2 |
| Molecular Weight | 275.01 |
| CAS Registry Number | 64046-75-9 |
| SMILES | C1=C([As](\C=C\Cl)/C=C/Cl)C=CC=C1 |
| InChI | 1S/C10H9AsCl2/c12-8-6-11(7-9-13)10-4-2-1-3-5-10/h1-9H/b8-6+,9-7+ |
| InChIKey | PPXHVTNSRXBMBJ-CDJQDVQCSA-N |
| Boiling point | 272.478°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 103.495°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Bis(2-Chlorovinyl)Phenylarsine |