|
CAS#: 64047-88-7 Product: Chloronitrophen No suppilers available for the product. |
| Name | Chloronitrophen |
|---|---|
| Synonyms | Sodium 2,4-Dichloro-6-Nitro-Phenolate; Chloronitrophen; Phenol, 2,4-Dichloro-6-Nitro-, Sodium Salt |
| Molecular Structure | ![]() |
| Molecular Formula | C6H2Cl2NNaO3 |
| Molecular Weight | 229.98 |
| CAS Registry Number | 64047-88-7 |
| SMILES | C1=C(Cl)C=C(C(=C1[N+]([O-])=O)[O-])Cl.[Na+] |
| InChI | 1S/C6H3Cl2NO3.Na/c7-3-1-4(8)6(10)5(2-3)9(11)12;/h1-2,10H;/q;+1/p-1 |
| InChIKey | QSYAEOJYDZZOHF-UHFFFAOYSA-M |
| Boiling point | 242.8°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 100.6°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Chloronitrophen |