|
CAS#: 6405-80-7 Product: 4-[3-(Amidino)Guanidino]Benzenesulfonic Acid No suppilers available for the product. |
| Name | 4-[3-(Amidino)Guanidino]Benzenesulfonic Acid |
|---|---|
| Synonyms | 4-[(Amino-Guanidino-Methylene)Amino]Benzenesulfonic Acid; 4-[(Amino-Guanidinomethylene)Amino]Benzenesulfonic Acid; Benzenesulfonic Acid, 4-[[[(Aminoiminomethyl)Amino]Iminomethyl]Amino]- |
| Molecular Structure | ![]() |
| Molecular Formula | C8H11N5O3S |
| Molecular Weight | 257.27 |
| CAS Registry Number | 6405-80-7 |
| SMILES | C1=C([S](O)(=O)=O)C=CC(=C1)N=C(N=C(N)N)N |
| InChI | 1S/C8H11N5O3S/c9-7(10)13-8(11)12-5-1-3-6(4-2-5)17(14,15)16/h1-4H,(H,14,15,16)(H6,9,10,11,12,13) |
| InChIKey | MURZSIQUBHOHPQ-UHFFFAOYSA-N |
| Density | 1.712g/cm3 (Cal.) |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 4-[3-(Amidino)Guanidino]Benzenesulfonic Acid |