|
CAS#: 64080-43-9 Product: 1,1,2,3,3-Pentafluoro-3-[(Trifluorovinyl)Oxy]Propene No suppilers available for the product. |
| Name | 1,1,2,3,3-Pentafluoro-3-[(Trifluorovinyl)Oxy]Propene |
|---|---|
| Synonyms | 1,1,2-Trifluoro-2-(1,1,2,3,3-Pentafluoroprop-2-Enoxy)Ethylene; 1,1,2,3,3-Pentafluoro-3-((Trifluorovinyl)Oxy)Propene |
| Molecular Structure | ![]() |
| Molecular Formula | C5F8O |
| Molecular Weight | 228.04 |
| CAS Registry Number | 64080-43-9 |
| EINECS | 264-659-8 |
| SMILES | C(F)(F)=C(F)OC(F)(F)C(F)=C(F)F |
| InChI | 1S/C5F8O/c6-1(2(7)8)5(12,13)14-4(11)3(9)10 |
| InChIKey | NKCGXGYJCHOICG-UHFFFAOYSA-N |
| Density | 1.546g/cm3 (Cal.) |
|---|---|
| Boiling point | 79.515°C at 760 mmHg (Cal.) |
| Flash point | 7.061°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,1,2,3,3-Pentafluoro-3-[(Trifluorovinyl)Oxy]Propene |