|
CAS#: 64098-32-4 Product: Zapizolam No suppilers available for the product. |
| Name | Zapizolam |
|---|---|
| Synonyms | D-13,129; D-13129 |
| Molecular Structure | ![]() |
| Molecular Formula | C15H9Cl2N5 |
| Molecular Weight | 330.18 |
| CAS Registry Number | 64098-32-4 |
| EINECS | 264-670-8 |
| SMILES | C1=CC(=NC3=C1[N]2C(=NN=C2)CN=C3C4=CC=CC=C4Cl)Cl |
| InChI | 1S/C15H9Cl2N5/c16-10-4-2-1-3-9(10)14-15-11(5-6-12(17)20-15)22-8-19-21-13(22)7-18-14/h1-6,8H,7H2 |
| InChIKey | FOWABKOXWTZAKY-UHFFFAOYSA-N |
| Density | 1.585g/cm3 (Cal.) |
|---|---|
| Boiling point | 546.217°C at 760 mmHg (Cal.) |
| Flash point | 284.142°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Zapizolam |