Online Database of Chemicals from Around the World
|
CAS#: 64123-64-4 Product: 2-(Chloromethyl)-1-(1-Methylethyl)-4-Nitrobenzene No suppilers available for the product. |
| Name | 2-(Chloromethyl)-1-(1-Methylethyl)-4-Nitrobenzene |
|---|---|
| Synonyms | 2-(Chloromethyl)-1-Isopropyl-4-Nitro-Benzene; 2-(Chloromethyl)-1-Isopropyl-4-Nitrobenzene; 2-(Chloromethyl)-4-Nitro-1-Propan-2-Yl-Benzene |
| Molecular Structure |  |
| Molecular Formula | C10H12ClNO2 |
| Molecular Weight | 213.66 |
| CAS Registry Number | 64123-64-4 |
| EINECS | 264-681-8 |
| SMILES | C1=C(C=CC(=C1CCl)C(C)C)[N+]([O-])=O |
| InChI | 1S/C10H12ClNO2/c1-7(2)10-4-3-9(12(13)14)5-8(10)6-11/h3-5,7H,6H2,1-2H3 |
| InChIKey | BCSRQPDGMAVORY-UHFFFAOYSA-N |
| Density | 1.193g/cm3 (Cal.) |
|---|---|
| Boiling point | 316.699°C at 760 mmHg (Cal.) |
| Flash point | 145.335°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(Chloromethyl)-1-(1-Methylethyl)-4-Nitrobenzene |