| International Laboratory Limited | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (650) 278-9963 | |||
![]() |
admin@intlab.org | |||
| Chemical manufacturer since 2002 | ||||
| Name | (12S,15S)-15-Hydroxy-11,16-dioxo-15,20-dihydrosenecionan-12-yl acetate |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C20H29NO7 |
| Molecular Weight | 395.45 |
| CAS Registry Number | 64147-40-6 |
| EINECS | 264-705-7 |
| SMILES | CC[C@@]1(C[C@H]([C@](C(=O)OCC2=CCN3[C@H]2[C@@H](CC3)OC1=O)(C)OC(=O)C)C)O |
| InChI | 1S/C20H29NO7/c1-5-20(25)10-12(2)19(4,28-13(3)22)17(23)26-11-14-6-8-21-9-7-15(16(14)21)27-18(20)24/h6,12,15-16,25H,5,7-11H2,1-4H3/t12-,15-,16-,19+,20+/m1/s1 |
| InChIKey | IYLGZMTXKJYONK-OZZRQTCFSA-N |
| Density | 1.3±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 584.1±50.0°C at 760 mmHg (Cal.) |
| Flash point | 307.1±30.1°C (Cal.) |
| (1) | Akihiro Kushima and Bilge Yildiz. Oxygen ion diffusivity in strained yttria stabilized zirconia: where is the fastest strain?, J. Mater. Chem., 2010, 20, 4809. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for (12S,15S)-15-Hydroxy-11,16-dioxo-15,20-dihydrosenecionan-12-yl acetate |