| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| International Laboratory Limited | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (650) 278-9963 | |||
![]() |
admin@intlab.org | |||
| Chemical manufacturer since 2002 | ||||
| SL Drugs and Pharmaceuticals Pvt. Ltd. | India | Inquire | ||
|---|---|---|---|---|
![]() |
+91 (40) 6661-1133 | |||
![]() |
enquiry@sldrugs.com | |||
| Chemical distributor since 1999 | ||||
| TimTec | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (302) 292-8500 | |||
![]() |
info@timtec.com | |||
| Chemical manufacturer | ||||
| Name | 1-Methyl-3-Phenylindan |
|---|---|
| Synonyms | 1-Methyl-3-Phenyl-Indane; 1-Methyl-3-Phenylindane; 1-Methyl-3-Phenylindan |
| Molecular Structure | ![]() |
| Molecular Formula | C16H16 |
| Molecular Weight | 208.30 |
| CAS Registry Number | 6416-39-3 |
| EINECS | 229-125-0 |
| SMILES | C1=CC=CC2=C1C(CC2C)C3=CC=CC=C3 |
| InChI | 1S/C16H16/c1-12-11-16(13-7-3-2-4-8-13)15-10-6-5-9-14(12)15/h2-10,12,16H,11H2,1H3 |
| InChIKey | JHIDJKSBZPNVKZ-UHFFFAOYSA-N |
| Density | 1.028g/cm3 (Cal.) |
|---|---|
| Boiling point | 312.937°C at 760 mmHg (Cal.) |
| Flash point | 148.06°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Methyl-3-Phenylindan |