|
CAS#: 641638-37-1 Product: Bis(2-methyl-2-propanyl) (4-bromophenyl)malonate No suppilers available for the product. |
| Name | Bis(2-methyl-2-propanyl) (4-bromophenyl)malonate |
|---|---|
| Synonyms | (4-Bromophényl)malonate de bis(2-méthyl-2-propanyle); 2-(4-BROMOPHENYL)-PROPANEDIOICACID1,3-BIS-T-BUTYLESTER |
| Molecular Structure | ![]() |
| Molecular Formula | C17H23BrO4 |
| Molecular Weight | 371.27 |
| CAS Registry Number | 641638-37-1 |
| SMILES | CC(C)(C)OC(=O)C(c1ccc(cc1)Br)C(=O)OC(C)(C)C |
| InChI | 1S/C17H23BrO4/c1-16(2,3)21-14(19)13(15(20)22-17(4,5)6)11-7-9-12(18)10-8-11/h7-10,13H,1-6H3 |
| InChIKey | DSFWQGCMVGWAON-UHFFFAOYSA-N |
| Density | 1.3±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 396.6±27.0°C at 760 mmHg (Cal.) |
| Flash point | 193.7±23.7°C (Cal.) |
| Refractive index | 1.513 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Bis(2-methyl-2-propanyl) (4-bromophenyl)malonate |