|
CAS#: 6417-51-2 Product: 7,14-Diphenyldiindolo[3,2,1-De:3',2',1'-ij][1,5]Naphthyridine-6,13-Dione No suppilers available for the product. |
| Name | 7,14-Diphenyldiindolo[3,2,1-De:3',2',1'-ij][1,5]Naphthyridine-6,13-Dione |
|---|---|
| Synonyms | Diindolo(3,2,1-De:3',2',1'-Ij)(1,5)Naphthyridine-6,13-Dione, 7,14-Diphenyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C32H18N2O2 |
| Molecular Weight | 462.51 |
| CAS Registry Number | 6417-51-2 |
| EINECS | 229-141-8 |
| SMILES | C1=CC=C(C=C1)C4=C3C2=C(C=CC=C2)N8C3=C6N(C4=O)C5=C(C=CC=C5)C6=C(C7=CC=CC=C7)C8=O |
| InChI | 1S/C32H18N2O2/c35-31-25(19-11-3-1-4-12-19)27-21-15-7-9-17-23(21)34-29(27)30-28(22-16-8-10-18-24(22)33(30)31)26(32(34)36)20-13-5-2-6-14-20/h1-18H |
| InChIKey | GUBZLBFYUBKAGY-UHFFFAOYSA-N |
| Density | 1.501g/cm3 (Cal.) |
|---|---|
| Boiling point | 701.236°C at 760 mmHg (Cal.) |
| Flash point | 325.401°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 7,14-Diphenyldiindolo[3,2,1-De:3',2',1'-ij][1,5]Naphthyridine-6,13-Dione |