|
CAS#: 64188-64-3 Product: N-Benzylphenanthrene-9,10-Imine No suppilers available for the product. |
| Name | N-Benzylphenanthrene-9,10-Imine |
|---|---|
| Synonyms | 1A,9B-Dihydro-1-(Phenylmethyl)-1H-Phenanthro(9,10-B)Azirine; Brn 1581641; Ccris 2138 |
| Molecular Structure | ![]() |
| Molecular Formula | C21H17N |
| Molecular Weight | 283.37 |
| CAS Registry Number | 64188-64-3 |
| SMILES | C1=CC=CC3=C1C2N(C2C4=C3C=CC=C4)CC5=CC=CC=C5 |
| InChI | 1S/C21H17N/c1-2-8-15(9-3-1)14-22-20-18-12-6-4-10-16(18)17-11-5-7-13-19(17)21(20)22/h1-13,20-21H,14H2 |
| InChIKey | LZJAUXDGBHATJG-UHFFFAOYSA-N |
| Density | 1.21g/cm3 (Cal.) |
|---|---|
| Boiling point | 419.132°C at 760 mmHg (Cal.) |
| Flash point | 184.296°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-Benzylphenanthrene-9,10-Imine |