Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| International Laboratory Limited | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (650) 278-9963 | |||
|
admin@intlab.org | |||
| Chemical manufacturer since 2002 | ||||
| Name | 2-Diacetylaminofluorene |
|---|---|
| Synonyms | N-Ethanoyl-N-(9H-Fluoren-2-Yl)Ethanamide; Acetamide, N-Fluoren-2-Yldi-; Diacetamide, N-Fluoren-2-Yl- |
| Molecular Structure |  |
| Molecular Formula | C17H15NO2 |
| Molecular Weight | 265.31 |
| CAS Registry Number | 642-65-9 |
| EINECS | 211-386-7 |
| SMILES | C3=C2C1=C(C=CC=C1)CC2=CC(=C3)N(C(C)=O)C(C)=O |
| InChI | 1S/C17H15NO2/c1-11(19)18(12(2)20)15-7-8-17-14(10-15)9-13-5-3-4-6-16(13)17/h3-8,10H,9H2,1-2H3 |
| InChIKey | CUEUMJJOLJYAPL-UHFFFAOYSA-N |
| Density | 1.242g/cm3 (Cal.) |
|---|---|
| Boiling point | 528.055°C at 760 mmHg (Cal.) |
| Flash point | 260.067°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 2-Diacetylaminofluorene |