Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| International Laboratory Limited | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (650) 278-9963 | |||
|
admin@intlab.org | |||
| Chemical manufacturer since 2002 | ||||
| Name | (10E)-19-Amino-13-hydroxy-8,14-dimethoxy-4,10,12,16-tetramethyl-3,20,22-trioxo-2-azabicyclo[16.3.1]docosa-1(21),4,6,10,18-pentaen-9-yl carbamate |
|---|---|
| Synonyms | 17-Amino Geldanamycin; 17-Amino-17-demethoxygeldanamycin; 17-Aminodemethoxygeldanamycin |
| Molecular Structure | ![CAS#: 64202-81-9, (10E)-19-Amino-13-hydroxy-8,14-dimethoxy-4,10,12,16-tetramethyl-3,20,22-trioxo-2-azabicyclo[16.3.1]docosa-1(21),4,6,10,18-pentaen-9-yl carbamate](/moreStructures/64202-81-9.gif) |
| Molecular Formula | C28H39N3O8 |
| Molecular Weight | 545.62 |
| CAS Registry Number | 64202-81-9 |
| SMILES | O=C\1C(\N)=C2/C(=O)/C(=C/1)NC(=O)\C(=C\C=C\C(OC)C(OC(=O)N)/C(=C/C(C)C(O)C(OC)CC(C)C2)C)C |
| InChI | 1S/C28H39N3O8/c1-14-10-18-23(29)20(32)13-19(25(18)34)31-27(35)15(2)8-7-9-21(37-5)26(39-28(30)36)17(4)12-16(3)24(33)22(11-14)38-6/h7-9,12-14,16,21-22,24,26,33H,10-11,29H2,1-6H3,(H2,30,36)(H,31,35)/b9-7+,15-8+,17-12+ |
| InChIKey | XYFFWTYOFPSZRM-FHLIFQJMSA-N |
| Density | 1.252g/cm3 (Cal.) |
|---|---|
| Boiling point | 777.782°C at 760 mmHg (Cal.) |
| Flash point | 424.187°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (10E)-19-Amino-13-hydroxy-8,14-dimethoxy-4,10,12,16-tetramethyl-3,20,22-trioxo-2-azabicyclo[16.3.1]docosa-1(21),4,6,10,18-pentaen-9-yl carbamate |