Online Database of Chemicals from Around the World
|
CAS#: 6424-69-7 Product: 5-Chloro-2-(5,7-Dichloro-3-Oxo-1-Benzothiophen-2(3H)-Ylidene)-7-Methoxy-4-Methyl-1,2-Dihydro-3H-Indol-3-One No suppilers available for the product. |
| Name | 5-Chloro-2-(5,7-Dichloro-3-Oxo-1-Benzothiophen-2(3H)-Ylidene)-7-Methoxy-4-Methyl-1,2-Dihydro-3H-Indol-3-One |
|---|---|
| Molecular Structure |  |
| Molecular Formula | C18H10Cl3NO3S |
| Molecular Weight | 426.70 |
| CAS Registry Number | 6424-69-7 |
| SMILES | Cc1c(cc(c2c1C(=O)C(=C3C(=O)c4cc(cc(c4S3)Cl)Cl)N2)OC)Cl |
| InChI | 1S/C18H10Cl3NO3S/c1-6-9(20)5-11(25-2)13-12(6)16(24)14(22-13)18-15(23)8-3-7(19)4-10(21)17(8)26-18/h3-5,22H,1-2H3 |
| InChIKey | CFDCBVJUEASQPX-UHFFFAOYSA-N |
| Density | 1.613g/cm3 (Cal.) |
|---|---|
| Boiling point | 555.814°C at 760 mmHg (Cal.) |
| Flash point | 289.946°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Chloro-2-(5,7-Dichloro-3-Oxo-1-Benzothiophen-2(3H)-Ylidene)-7-Methoxy-4-Methyl-1,2-Dihydro-3H-Indol-3-One |