|
CAS#: 64299-06-5 Product: 5,6,11,12,17,18-Hexahydrocyclonona[1,2-b:4,5-b':7,8-b'']triindole No suppilers available for the product. |
| Name | 5,6,11,12,17,18-Hexahydrocyclonona[1,2-b:4,5-b':7,8-b'']triindole |
|---|---|
| Synonyms | 5,6,11,12,17,18-Hexahydrocyclononal(1,2-B-4,5-B'-7,8-B'')Triindole; 5,6,11,12,17,18-Hexahydrocyclononatriindole; Cyclonona(1,2-B:4,5-B':7,8'')Trindole, 5,6,11,12,17,18-Hexahydro- |
| Molecular Structure | ![]() |
| Molecular Formula | C27H21N3 |
| Molecular Weight | 387.48 |
| CAS Registry Number | 64299-06-5 |
| SMILES | C1=CC=CC2=C1C7=C([NH]2)CC3=C([NH]C4=C3C=CC=C4)CC5=C([NH]C6=C5C=CC=C6)C7 |
| InChI | 1S/C27H21N3/c1-4-10-22-16(7-1)19-13-26-21(18-9-3-5-11-23(18)29-26)15-27-20(14-25(19)28-22)17-8-2-6-12-24(17)30-27/h1-12,28-30H,13-15H2 |
| InChIKey | RJTQDPWAXDDRCB-UHFFFAOYSA-N |
| Density | 1.353g/cm3 (Cal.) |
|---|---|
| Boiling point | 651.983°C at 760 mmHg (Cal.) |
| Flash point | 291.097°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5,6,11,12,17,18-Hexahydrocyclonona[1,2-b:4,5-b':7,8-b'']triindole |