|
CAS#: 64323-57-5 Product: 1,3,4,6,8,9b-Hexaazaphenalene No suppilers available for the product. |
| Name | 1,3,4,6,8,9b-Hexaazaphenalene |
|---|---|
| Synonyms | 1,3,4,6,8-Pentaazacycl(3.3.3)Azine |
| Molecular Structure | ![]() |
| Molecular Formula | C7H4N6 |
| Molecular Weight | 172.15 |
| CAS Registry Number | 64323-57-5 |
| SMILES | C3=C2N1C(=NC=NC1=NC=N2)C=N3 |
| InChI | 1S/C7H4N6/c1-5-9-3-11-7-12-4-10-6(2-8-1)13(5)7/h1-4H |
| InChIKey | DMKFTFMRVUXACD-UHFFFAOYSA-N |
| Density | 1.831g/cm3 (Cal.) |
|---|---|
| Boiling point | 336.309°C at 760 mmHg (Cal.) |
| Flash point | 157.194°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,3,4,6,8,9b-Hexaazaphenalene |