|
CAS#: 64375-26-4 Product: 2,2,3,3-Tetrafluoro-1,1-Dimethylpropyl Methacrylate No suppilers available for the product. |
| Name | 2,2,3,3-Tetrafluoro-1,1-Dimethylpropyl Methacrylate |
|---|---|
| Synonyms | (2,2,3,3-Tetrafluoro-1,1-Dimethyl-Propyl) 2-Methylprop-2-Enoate; 2-Methylprop-2-Enoic Acid (2,2,3,3-Tetrafluoro-1,1-Dimethylpropyl) Ester; 2-Methylacrylic Acid (2,2,3,3-Tetrafluoro-1,1-Dimethyl-Propyl) Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C9H12F4O2 |
| Molecular Weight | 228.19 |
| CAS Registry Number | 64375-26-4 |
| EINECS | 264-855-3 |
| SMILES | CC(OC(=O)C(=C)C)(C(F)(F)C(F)F)C |
| InChI | 1S/C9H12F4O2/c1-5(2)6(14)15-8(3,4)9(12,13)7(10)11/h7H,1H2,2-4H3 |
| InChIKey | SXLLWDJFRZODKV-UHFFFAOYSA-N |
| Density | 1.154g/cm3 (Cal.) |
|---|---|
| Boiling point | 191.147°C at 760 mmHg (Cal.) |
| Flash point | 67.854°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,2,3,3-Tetrafluoro-1,1-Dimethylpropyl Methacrylate |