|
CAS#: 64426-40-0 Product: (1,1-Dimethylethoxy)Ethenyl-Silanediol Diacetate No suppilers available for the product. |
| Name | (1,1-Dimethylethoxy)Ethenyl-Silanediol Diacetate |
|---|---|
| Synonyms | (Acetoxy-Tert-Butoxy-Vinyl-Silyl) Acetate; Acetic Acid (Acetoxy-Tert-Butoxy-Vinylsilyl) Ester; Acetic Acid (Acetoxy-Tert-Butoxy-Vinyl-Silyl) Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C10H18O5Si |
| Molecular Weight | 246.34 |
| CAS Registry Number | 64426-40-0 |
| SMILES | CC(O[Si](OC(=O)C)(OC(C)(C)C)C=C)=O |
| InChI | 1S/C10H18O5Si/c1-7-16(13-8(2)11,14-9(3)12)15-10(4,5)6/h7H,1H2,2-6H3 |
| InChIKey | MKIGOIXSOYVYHF-UHFFFAOYSA-N |
| Density | 1.036g/cm3 (Cal.) |
|---|---|
| Boiling point | 239.817°C at 760 mmHg (Cal.) |
| Flash point | 82.225°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (1,1-Dimethylethoxy)Ethenyl-Silanediol Diacetate |