|
CAS#: 64466-48-4 Product: 1-(6,7-Dimethoxy-2-Benzofuranyl)Ethanone No suppilers available for the product. |
| Name | 1-(6,7-Dimethoxy-2-Benzofuranyl)Ethanone |
|---|---|
| Synonyms | 1-(6,7-Dimethoxybenzofuran-3-Yl)Ethanone; 1-(6,7-Dimethoxy-3-Benzofuranyl)Ethanone; 1-(6,7-Dimethoxy-2-Benzofuranyl)Ethanone |
| Molecular Structure | ![]() |
| Molecular Formula | C12H12O4 |
| Molecular Weight | 220.22 |
| CAS Registry Number | 64466-48-4 |
| SMILES | C1=CC(=C(C2=C1C(=CO2)C(C)=O)OC)OC |
| InChI | 1S/C12H12O4/c1-7(13)9-6-16-11-8(9)4-5-10(14-2)12(11)15-3/h4-6H,1-3H3 |
| InChIKey | NJYJDKKWBOFQLS-UHFFFAOYSA-N |
| Density | 1.185g/cm3 (Cal.) |
|---|---|
| Boiling point | 325.882°C at 760 mmHg (Cal.) |
| Flash point | 150.888°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(6,7-Dimethoxy-2-Benzofuranyl)Ethanone |