| International Laboratory Limited | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (650) 278-9963 | |||
![]() |
admin@intlab.org | |||
| Chemical manufacturer since 2002 | ||||
| Manchester Organics Ltd. | UK | Inquire | ||
|---|---|---|---|---|
![]() |
+44 (1928) 710-200 | |||
![]() |
info@manchesterorganics.com | |||
| Chemical manufacturer | ||||
| P and M Invest Ltd. | Russian Federation | Inquire | ||
|---|---|---|---|---|
![]() |
+7 (495) 135-6494 | |||
![]() |
sales@fluorine.ru | |||
| Chemical manufacturer | ||||
| SynQuest Labs, Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (386) 462-0788 | |||
![]() |
info@synquestlabs.com | |||
| Chemical manufacturer | ||||
| Zylexa Pharma Ltd. | UK | Inquire | ||
|---|---|---|---|---|
![]() |
+44 (845) 299-6009/ | |||
![]() |
sales@zylexa-pharma.com,enquiries@zylexa-pharma.com | |||
| Chemical manufacturer | ||||
| Name | 4,4,5,5-Tetrachloro-2,2-bis(trifluoromethyl)-1,3-dioxolane |
|---|---|
| Synonyms | 2,2-Bis(trifluoromethyl)tetrachloro-1,3-dioxolane; 2,2-Bis(trifluoromethyl)tetrachloro-1,3-dioxolane, >97%; MFCD16619610 |
| Molecular Structure | ![]() |
| Molecular Formula | C5Cl4F6O2 |
| Molecular Weight | 347.85 |
| CAS Registry Number | 64499-81-6 |
| SMILES | C1(C(OC(O1)(C(F)(F)F)C(F)(F)F)(Cl)Cl)(Cl)Cl |
| InChI | 1S/C5Cl4F6O2/c6-2(7)3(8,9)17-1(16-2,4(10,11)12)5(13,14)15 |
| InChIKey | RSNKMTZZWVFGES-UHFFFAOYSA-N |
| Density | 1.9±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 198.5±40.0°C at 760 mmHg (Cal.) |
| Flash point | 73.8±27.3°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 4,4,5,5-Tetrachloro-2,2-bis(trifluoromethyl)-1,3-dioxolane |