| ChemBridge Corporation | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (858) 451-7400 | |||
![]() |
sales@chembridge.com | |||
| Chemical manufacturer | ||||
| Vitas-M | Russian Federation | Inquire | ||
|---|---|---|---|---|
![]() |
+7 (906) 781-2021 | |||
![]() |
vitas@vitasmlab.com | |||
| Chemical manufacturer since 1998 | ||||
| Name | 1,3-Dimethyl-5,5-Diphenyl-2,4-Imidazolidinedione |
|---|---|
| Synonyms | 1,3-Dimethyl derivative of 5,5-Diphenylhydantoin; 1,3-dimethyl-5,5-diphenyl-2,4-imidazolidinedione; 1,3-Dimethyl-5,5-diphenylhydantoin |
| Molecular Structure | ![]() |
| Molecular Formula | C17H16N2O2 |
| Molecular Weight | 280.32 |
| CAS Registry Number | 6456-01-5 |
| SMILES | O=C1N(C(=O)N(C)C1(c2ccccc2)c3ccccc3)C |
| InChI | 1S/C17H16N2O2/c1-18-15(20)17(19(2)16(18)21,13-9-5-3-6-10-13)14-11-7-4-8-12-14/h3-12H,1-2H3 |
| InChIKey | AQYFZMVWTWUJKL-UHFFFAOYSA-N |
| Density | 1.216g/cm3 (Cal.) |
|---|---|
| Boiling point | 398.453°C at 760 mmHg (Cal.) |
| Flash point | 167.865°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,3-Dimethyl-5,5-Diphenyl-2,4-Imidazolidinedione |