|
CAS#: 64609-73-0 Product: Glucitollysine No suppilers available for the product. |
| Name | Glucitollysine |
|---|---|
| Synonyms | D-Glucitol, 1-((5-Amino-5-Carboxypentyl)Amino)-1-Deoxy-, (S)-; Glucitol-Lysine; Epsilon-N-(1-Deoxy-D-Glucitol-1-Yl)L-Lysine |
| Molecular Structure | ![]() |
| Molecular Formula | C12H26N2O7 |
| Molecular Weight | 310.35 |
| CAS Registry Number | 64609-73-0 |
| SMILES | [C@H](O)([C@H](O)[C@H](O)CO)[C@@H](O)CNCCCC[C@H](N)C(=O)O |
| InChI | 1S/C12H26N2O7/c13-7(12(20)21)3-1-2-4-14-5-8(16)10(18)11(19)9(17)6-15/h7-11,14-19H,1-6,13H2,(H,20,21)/t7-,8-,9+,10+,11+/m0/s1 |
| InChIKey | JNFQXAUVKUQSKQ-FBDQPXRJSA-N |
| Density | 1.391g/cm3 (Cal.) |
|---|---|
| Boiling point | 664.075°C at 760 mmHg (Cal.) |
| Flash point | 355.42°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Glucitollysine |