|
CAS#: 64634-93-1 Product: 3-Methyl-4-(2,6,6-Trimethyl-2-Cyclohexen-1-Yl)Butan-2-One No suppilers available for the product. |
| Name | 3-Methyl-4-(2,6,6-Trimethyl-2-Cyclohexen-1-Yl)Butan-2-One |
|---|---|
| Synonyms | 3-Methyl-4-(2,6,6-Trimethyl-2-Cyclohexen-1-Yl)Butan-2-One |
| Molecular Structure | ![]() |
| Molecular Formula | C14H24O |
| Molecular Weight | 208.34 |
| CAS Registry Number | 64634-93-1 |
| EINECS | 264-982-4 |
| SMILES | C(C1C(CCC=C1C)(C)C)C(C(=O)C)C |
| InChI | 1S/C14H24O/c1-10-7-6-8-14(4,5)13(10)9-11(2)12(3)15/h7,11,13H,6,8-9H2,1-5H3 |
| InChIKey | SYLQLBRNBHRVCR-UHFFFAOYSA-N |
| Density | 0.865g/cm3 (Cal.) |
|---|---|
| Boiling point | 270.77°C at 760 mmHg (Cal.) |
| Flash point | 97.054°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Methyl-4-(2,6,6-Trimethyl-2-Cyclohexen-1-Yl)Butan-2-One |