|
CAS#: 64675-15-6 Product: Procaine Azide, Monohydrochloride No suppilers available for the product. |
| Name | Procaine Azide, Monohydrochloride |
|---|---|
| Synonyms | 4-Azidobenzoic Acid 2-Diethylaminoethyl Ester; Benzoic Aicd, 4-Azido-, 2-(Diethylamino)Ethyl Ester; Procaine Azide |
| Molecular Structure | ![]() |
| Molecular Formula | C13H18N4O2 |
| Molecular Weight | 262.31 |
| CAS Registry Number | 64675-15-6 |
| SMILES | [N+](=[N-])=NC1=CC=C(C(=O)OCCN(CC)CC)C=C1 |
| InChI | 1S/C13H18N4O2/c1-3-17(4-2)9-10-19-13(18)11-5-7-12(8-6-11)15-16-14/h5-8H,3-4,9-10H2,1-2H3 |
| InChIKey | NQFWLQVMZRBRPQ-UHFFFAOYSA-N |
| Market Analysis Reports |
| List of Reports Available for Procaine Azide, Monohydrochloride |