|
CAS#: 6475-05-4 Product: Strictamine No suppilers available for the product. |
| Name | Strictamine |
|---|---|
| Synonyms | Akuammiline, Deacetyldeformo-; Deacetyldeformoakuammiline; Nsc180521 |
| Molecular Structure | ![]() |
| Molecular Formula | C20H22N2O2 |
| Molecular Weight | 322.41 |
| CAS Registry Number | 6475-05-4 |
| SMILES | C2=C1C34C(=NC1=CC=C2)C5N(CC3)C\C(C(C4C(=O)OC)C5)=C/C |
| InChI | 1S/C20H22N2O2/c1-3-12-11-22-9-8-20-14-6-4-5-7-15(14)21-18(20)16(22)10-13(12)17(20)19(23)24-2/h3-7,13,16-17H,8-11H2,1-2H3/b12-3+ |
| InChIKey | LITYYRLWHAQJQS-KGVSQERTSA-N |
| Density | 1.373g/cm3 (Cal.) |
|---|---|
| Boiling point | 459.202°C at 760 mmHg (Cal.) |
| Flash point | 231.517°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Strictamine |