|
CAS#: 6477-64-1 Product: Lead Dipicrate No suppilers available for the product. |
| Name | Lead Dipicrate |
|---|---|
| Synonyms | Plumbous 2,4,6-Trinitrophenolate; Plumbous Dipicrate |
| Molecular Structure | ![]() |
| Molecular Formula | C12H4N6O14Pb |
| Molecular Weight | 663.40 |
| CAS Registry Number | 6477-64-1 |
| EINECS | 229-335-2 |
| SMILES | C1=C([N+]([O-])=O)C=C([N+]([O-])=O)C(=C1[N+]([O-])=O)[O-].C2=C([N+]([O-])=O)C=C([N+]([O-])=O)C(=C2[N+]([O-])=O)[O-].[Pb++] |
| InChI | 1S/2C6H3N3O7.Pb/c2*10-6-4(8(13)14)1-3(7(11)12)2-5(6)9(15)16;/h2*1-2,10H;/q;;+2/p-2 |
| InChIKey | MHVVRZIRWITSIP-UHFFFAOYSA-L |
| Boiling point | 303.6°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 133.9°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Lead Dipicrate |