|
CAS#: 64894-46-8 Product: N'-[3-(Trimethoxysilyl)Propyl]-N-[(Vinylphenyl)Methyl]Ethylenediamine Hydrochloride No suppilers available for the product. |
| Name | N'-[3-(Trimethoxysilyl)Propyl]-N-[(Vinylphenyl)Methyl]Ethylenediamine Hydrochloride |
|---|---|
| Synonyms | N-(3-Trimethoxysilylpropyl)-N'-[(2-Vinylphenyl)Methyl]Ethane-1,2-Diamine Hydrochloride; 3-Trimethoxysilylpropyl-[2-[(2-Vinylbenzyl)Amino]Ethyl]Amine Hydrochloride |
| Molecular Structure | ![]() |
| Molecular Formula | C17H31ClN2O3Si |
| Molecular Weight | 374.98 |
| CAS Registry Number | 64894-46-8 |
| EINECS | 265-265-9 |
| SMILES | [Si](OC)(OC)(OC)CCCNCCNCC1=CC=CC=C1C=C.[H+].[Cl-] |
| InChI | 1S/C17H30N2O3Si.ClH/c1-5-16-9-6-7-10-17(16)15-19-13-12-18-11-8-14-23(20-2,21-3)22-4;/h5-7,9-10,18-19H,1,8,11-15H2,2-4H3;1H |
| InChIKey | MYWJOHLSXLTXCV-UHFFFAOYSA-N |
| Boiling point | 401.9°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 196.9°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N'-[3-(Trimethoxysilyl)Propyl]-N-[(Vinylphenyl)Methyl]Ethylenediamine Hydrochloride |