Online Database of Chemicals from Around the World
| International Laboratory Limited | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (650) 278-9963 | |||
 |
admin@intlab.org | |||
| Chemical manufacturer since 2002 | ||||
| Name | (2R,3R)-2,3-Butanediyl bis(4-methylbenzenesulfonate) |
|---|---|
| Synonyms | (2R,3R)-(+)-2,3-BUTANEDIOLDI-P-TOSYLATE,99 |
| Molecular Structure |  |
| Molecular Formula | C18H22O6S2 |
| Molecular Weight | 398.49 |
| CAS Registry Number | 64896-27-1 |
| SMILES | O=S(=O)(O[C@H](C)[C@@H](C)OS(=O)(=O)c1ccc(C)cc1)c2ccc(C)cc2 |
| InChI | 1S/C18H22O6S2/c1-13-5-9-17(10-6-13)25(19,20)23-15(3)16(4)24-26(21,22)18-11-7-14(2)8-12-18/h5-12,15-16H,1-4H3/t15-,16-/m1/s1 |
| InChIKey | MFRBMNNZDFDJOF-HZPDHXFCSA-N |
| Density | 1.273g/cm3 (Cal.) |
|---|---|
| Boiling point | 550.151°C at 760 mmHg (Cal.) |
| Flash point | 286.521°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for (2R,3R)-2,3-Butanediyl bis(4-methylbenzenesulfonate) |