Online Database of Chemicals from Around the World
|
CAS#: 64924-66-9 Product: 2-(1-Ethylcyclopentyl)-4,6-Xylenol No suppilers available for the product. |
| Name | 2-(1-Ethylcyclopentyl)-4,6-Xylenol |
|---|---|
| Synonyms | 2-(1-Ethylcyclopentyl)-4,6-Dimethyl-Phenol; 2-(1-Ethylcyclopentyl)-4,6-Xylenol |
| Molecular Structure |  |
| Molecular Formula | C15H22O |
| Molecular Weight | 218.34 |
| CAS Registry Number | 64924-66-9 |
| EINECS | 265-282-1 |
| SMILES | C1=C(C=C(C(=C1C2(CCCC2)CC)O)C)C |
| InChI | 1S/C15H22O/c1-4-15(7-5-6-8-15)13-10-11(2)9-12(3)14(13)16/h9-10,16H,4-8H2,1-3H3 |
| InChIKey | JEDRDNRBDGFAHS-UHFFFAOYSA-N |
| Density | 0.993g/cm3 (Cal.) |
|---|---|
| Boiling point | 309.376°C at 760 mmHg (Cal.) |
| Flash point | 139.265°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(1-Ethylcyclopentyl)-4,6-Xylenol |