|
CAS#: 6493-28-3 Product: 8-(Propylthio)-3,7-Dihydro-1,3-Dimethyl-6-Thio-1H-Purin-2-One No suppilers available for the product. |
| Name | 8-(Propylthio)-3,7-Dihydro-1,3-Dimethyl-6-Thio-1H-Purin-2-One |
|---|---|
| Synonyms | 1,3-Dimethyl-8-Propylsulfanyl-6-Thioxo-7H-Purin-2-One; 1,3-Dimethyl-8-(Propylthio)-6-Thioxo-7H-Purin-2-One; Nciopen2_006178 |
| Molecular Structure | ![]() |
| Molecular Formula | C10H14N4OS2 |
| Molecular Weight | 270.37 |
| CAS Registry Number | 6493-28-3 |
| SMILES | C(SC2=NC1=C(C(N(C(N1C)=O)C)=S)[NH]2)CC |
| InChI | 1S/C10H14N4OS2/c1-4-5-17-9-11-6-7(12-9)13(2)10(15)14(3)8(6)16/h4-5H2,1-3H3,(H,11,12) |
| InChIKey | ZNLJVMLTVLQCCX-UHFFFAOYSA-N |
| Density | 1.444g/cm3 (Cal.) |
|---|---|
| Boiling point | 473.729°C at 760 mmHg (Cal.) |
| Flash point | 240.303°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 8-(Propylthio)-3,7-Dihydro-1,3-Dimethyl-6-Thio-1H-Purin-2-One |