|
CAS#: 64969-36-4 Product: [3,3'-Dimethyl[1,1'-Biphenyl]-4,4'-Diyl]Diammonium Bis(Sulphate) No suppilers available for the product. |
| Name | [3,3'-Dimethyl[1,1'-Biphenyl]-4,4'-Diyl]Diammonium Bis(Sulphate) |
|---|---|
| Synonyms | [4-(4-Azaniumyl-3-Methyl-Phenyl)-2-Methyl-Phenyl]Ammonium; Hydrogen Sulfate; [4-(4-Ammonio-3-Methylphenyl)-2-Methylphenyl]Ammonium; Hydrogen Sulfate; [4-(4-Ammonio-3-Methyl-Phenyl)-2-Methyl-Phenyl]Ammonium Dibisulfate |
| Molecular Structure | ![]() |
| Molecular Formula | C14H20N2O8S2 |
| Molecular Weight | 408.44 |
| CAS Registry Number | 64969-36-4 |
| EINECS | 265-294-7 |
| SMILES | O=[S]([O-])(=O)O.O=[S]([O-])(=O)O.C1=C(C(=CC=C1C2=CC=C([NH3+])C(=C2)C)[NH3+])C |
| InChI | 1S/C14H16N2.2H2O4S/c1-9-7-11(3-5-13(9)15)12-4-6-14(16)10(2)8-12;2*1-5(2,3)4/h3-8H,15-16H2,1-2H3;2*(H2,1,2,3,4) |
| InChIKey | ZLVMWVOMYIUKQF-UHFFFAOYSA-N |
| Boiling point | 361°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 205.1°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for [3,3'-Dimethyl[1,1'-Biphenyl]-4,4'-Diyl]Diammonium Bis(Sulphate) |