|
CAS#: 65021-27-4 Product: 3,3,7-Trimethylindan-5-Ol No suppilers available for the product. |
| Name | 3,3,7-Trimethylindan-5-Ol |
|---|---|
| Synonyms | 3,3,7-Trimethylindan-5-Ol; 3,3,7-Trimethyl-5-Indanol |
| Molecular Structure | ![]() |
| Molecular Formula | C12H16O |
| Molecular Weight | 176.26 |
| CAS Registry Number | 65021-27-4 |
| EINECS | 265-313-9 |
| SMILES | C1=C(O)C=C(C2=C1C(CC2)(C)C)C |
| InChI | 1S/C12H16O/c1-8-6-9(13)7-11-10(8)4-5-12(11,2)3/h6-7,13H,4-5H2,1-3H3 |
| InChIKey | QCHYMSYGCBJIQS-UHFFFAOYSA-N |
| Density | 1.027g/cm3 (Cal.) |
|---|---|
| Boiling point | 277.392°C at 760 mmHg (Cal.) |
| Flash point | 124.707°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,3,7-Trimethylindan-5-Ol |