|
CAS#: 65048-02-4 Product: 2-Aminomethyl-1-Ethyl-4,5,6,7-Tetrachloro -1H-Indole-3-Carboxylic Acid Ethyl Ester No suppilers available for the product. |
| Name | 2-Aminomethyl-1-Ethyl-4,5,6,7-Tetrachloro -1H-Indole-3-Carboxylic Acid Ethyl Ester |
|---|---|
| Synonyms | Ethyl 2-(Aminomethyl)-4,5,6,7-Tetrachloro-1-Ethyl-Indole-3-Carboxylate; 2-(Aminomethyl)-4,5,6,7-Tetrachloro-1-Ethyl-3-Indolecarboxylic Acid Ethyl Ester; 2-(Aminomethyl)-4,5,6,7-Tetrachloro-1-Ethyl-Indole-3-Carboxylic Acid Ethyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C14H14Cl4N2O2 |
| Molecular Weight | 384.09 |
| CAS Registry Number | 65048-02-4 |
| SMILES | C([N]1C(=C(C2=C1C(=C(C(=C2Cl)Cl)Cl)Cl)C(=O)OCC)CN)C |
| InChI | 1S/C14H14Cl4N2O2/c1-3-20-6(5-19)7(14(21)22-4-2)8-9(15)10(16)11(17)12(18)13(8)20/h3-5,19H2,1-2H3 |
| InChIKey | UIKGCIWRNVVQNY-UHFFFAOYSA-N |
| Density | 1.55g/cm3 (Cal.) |
|---|---|
| Boiling point | 531.121°C at 760 mmHg (Cal.) |
| Flash point | 275.012°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Aminomethyl-1-Ethyl-4,5,6,7-Tetrachloro -1H-Indole-3-Carboxylic Acid Ethyl Ester |