|
CAS#: 65048-75-1 Product: 3-(2,3-Dihydroxy-4-methoxyphenyl)-7-hydroxy-4H-chromen-4-one No suppilers available for the product. |
| Name | 3-(2,3-Dihydroxy-4-methoxyphenyl)-7-hydroxy-4H-chromen-4-one |
|---|---|
| Synonyms | KOPARIN; SDCCGMLS-0066413.P001 |
| Molecular Structure | ![]() |
| Molecular Formula | C16H12O6 |
| Molecular Weight | 300.26 |
| CAS Registry Number | 65048-75-1 |
| SMILES | COC1=C(C(=C(C=C1)C2=COC3=C(C2=O)C=CC(=C3)O)O)O |
| InChI | 1S/C16H12O6/c1-21-12-5-4-9(15(19)16(12)20)11-7-22-13-6-8(17)2-3-10(13)14(11)18/h2-7,17,19-20H,1H3 |
| InChIKey | SMOFGXHPWCTYQD-UHFFFAOYSA-N |
| Density | 1.5±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 574.3±50.0°C at 760 mmHg (Cal.) |
| Flash point | 219.4±23.6°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-(2,3-Dihydroxy-4-methoxyphenyl)-7-hydroxy-4H-chromen-4-one |