|
CAS#: 651-36-5 Product: 1-(Trichloromethyl)-2-(Trifluoromethyl)Benzene No suppilers available for the product. |
| Name | 1-(Trichloromethyl)-2-(Trifluoromethyl)Benzene |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C8H4Cl3F3 |
| Molecular Weight | 263.47 |
| CAS Registry Number | 651-36-5 |
| EINECS | 211-481-3 |
| SMILES | C1=CC=CC(=C1C(F)(F)F)C(Cl)(Cl)Cl |
| InChI | 1S/C8H4Cl3F3/c9-7(10,11)5-3-1-2-4-6(5)8(12,13)14/h1-4H |
| InChIKey | VDEUYVGUNSJXAE-UHFFFAOYSA-N |
| Density | 1.512g/cm3 (Cal.) |
|---|---|
| Boiling point | 232.712°C at 760 mmHg (Cal.) |
| Flash point | 110.333°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(Trichloromethyl)-2-(Trifluoromethyl)Benzene |