|
CAS#: 652-23-3 Product: 1,2,3,4,5-Pentafluoro-6-(Trifluorovinyl)Benzene No suppilers available for the product. |
| Name | 1,2,3,4,5-Pentafluoro-6-(Trifluorovinyl)Benzene |
|---|---|
| Synonyms | 1,2,3,4,5-Pentafluoro-6-(1,2,2-trifluorovinyl)benzene #; 2,3,4,5,6,7,8,8-Octafluorostyrene |
| Molecular Structure | ![]() |
| Molecular Formula | C8F8 |
| Molecular Weight | 248.07 |
| CAS Registry Number | 652-23-3 |
| SMILES | Fc1c(c(F)c(F)c(F)c1F)C(\F)=C(/F)F |
| InChI | 1S/C8F8/c9-2-1(4(11)8(15)16)3(10)6(13)7(14)5(2)12 |
| InChIKey | GZQZKLFXWPAMFW-UHFFFAOYSA-N |
| Density | 1.606g/cm3 (Cal.) |
|---|---|
| Boiling point | 123.272°C at 760 mmHg (Cal.) |
| Flash point | 27.068°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,2,3,4,5-Pentafluoro-6-(Trifluorovinyl)Benzene |