Online Database of Chemicals from Around the World
|
CAS#: 65222-36-8 Product: 6,11-Dimethyl-5H-pyrido(3',4':4,5)pyrrolo(2,3-g)isoquinoline No suppilers available for the product. |
| Name | 6,11-Dimethyl-5H-pyrido(3',4':4,5)pyrrolo(2,3-g)isoquinoline |
|---|---|
| Synonyms | 6,11-Dimethyl-5H-Pyrido(3',4':4,5)Pyrrolo(2,3-G)Isoquinoline; Br 76; Brn 0617428 |
| Molecular Structure |  |
| Molecular Formula | C16H13N3 |
| Molecular Weight | 247.30 |
| CAS Registry Number | 65222-36-8 |
| SMILES | C1=NC=CC3=C1C2=C(C4=C(C(=C2[NH]3)C)C=CN=C4)C |
| InChI | 1S/C16H13N3/c1-9-12-7-17-5-3-11(12)10(2)16-15(9)13-8-18-6-4-14(13)19-16/h3-8,19H,1-2H3 |
| InChIKey | YRCVFTSIMZLRFZ-UHFFFAOYSA-N |
| Density | 1.308g/cm3 (Cal.) |
|---|---|
| Boiling point | 524.755°C at 760 mmHg (Cal.) |
| Flash point | 249°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6,11-Dimethyl-5H-pyrido(3',4':4,5)pyrrolo(2,3-g)isoquinoline |