|
CAS#: 65235-94-1 Product: 2,6-Bis(Iodomethyl)Piperidine No suppilers available for the product. |
| Name | 2,6-Bis(Iodomethyl)Piperidine |
|---|---|
| Synonyms | 2,6-Bis(Iodomethyl)Piperidine; Piperidine, 2,6-Bis(Iodomethyl)-, Monohydrochloride |
| Molecular Structure | ![]() |
| Molecular Formula | C7H14ClI2N |
| Molecular Weight | 401.46 |
| CAS Registry Number | 65235-94-1 |
| SMILES | [H+].C(I)C1NC(CCC1)CI.[Cl-] |
| InChI | 1S/C7H13I2N.ClH/c8-4-6-2-1-3-7(5-9)10-6;/h6-7,10H,1-5H2;1H |
| InChIKey | GRZMHBQDGZKQAB-UHFFFAOYSA-N |
| Boiling point | 334.7°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 156.2°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,6-Bis(Iodomethyl)Piperidine |