|
CAS#: 65244-18-0 Product: Dimethyl 1-(4-Chlorophenyl)-3a,4,4a,6a,7,7alpha-Hexahydro-4,7-Methano-1H-[1,2]Diazeto[3,4-f]Benzotriazole-5,6-Dicarboxylate No suppilers available for the product. |
| Name | Dimethyl 1-(4-Chlorophenyl)-3a,4,4a,6a,7,7alpha-Hexahydro-4,7-Methano-1H-[1,2]Diazeto[3,4-f]Benzotriazole-5,6-Dicarboxylate |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C17H18ClN5O4 |
| Molecular Weight | 391.81 |
| CAS Registry Number | 65244-18-0 |
| EINECS | 265-658-5 |
| SMILES | C1=CC(=CC=C1N5C3C(C4C2N(N(C2C3C4)C(=O)OC)C(=O)OC)N=N5)Cl |
| InChI | 1S/C17H18ClN5O4/c1-26-16(24)22-14-10-7-11(15(14)23(22)17(25)27-2)13-12(10)19-20-21(13)9-5-3-8(18)4-6-9/h3-6,10-15H,7H2,1-2H3 |
| InChIKey | LBQLWRPHYYZOOI-UHFFFAOYSA-N |
| Density | 1.777g/cm3 (Cal.) |
|---|---|
| Boiling point | 500.259°C at 760 mmHg (Cal.) |
| Flash point | 256.348°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Dimethyl 1-(4-Chlorophenyl)-3a,4,4a,6a,7,7alpha-Hexahydro-4,7-Methano-1H-[1,2]Diazeto[3,4-f]Benzotriazole-5,6-Dicarboxylate |