|
CAS#: 65290-33-7 Product: Methacrylate-Maleate-Styrene Copolymer No suppilers available for the product. |
| Name | Methacrylate-Maleate-Styrene Copolymer |
|---|---|
| Synonyms | But-2-Enedioic Acid; Methacrylic Acid; Styrene; But-2-Enedioic Acid; Ethenylbenzene; 2-Methylprop-2-Enoic Acid |
| Molecular Formula | C16H18O6 |
| Molecular Weight | 306.31 |
| CAS Registry Number | 65290-33-7 |
| SMILES | O=C(O)\C=C/C(=O)O.CC(C(=O)O)=C.C1=C(C=CC=C1)C=C |
| InChI | 1S/C8H8.C4H4O4.C4H6O2/c1-2-8-6-4-3-5-7-8;5-3(6)1-2-4(7)8;1-3(2)4(5)6/h2-7H,1H2;1-2H,(H,5,6)(H,7,8);1H2,2H3,(H,5,6)/b;2-1-; |
| InChIKey | JLWNSSARRYMQHJ-FJOGWHKWSA-N |
| Boiling point | 145.2°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 31.1°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methacrylate-Maleate-Styrene Copolymer |