|
CAS#: 65302-94-5 Product: 4,4-Dimethyl-2-oxo-3-(phenylsulfanyl)pentyl acetate No suppilers available for the product. |
| Name | 4,4-Dimethyl-2-oxo-3-(phenylsulfanyl)pentyl acetate |
|---|---|
| Synonyms | 4,4-Dimethyl-2-oxo-3-(phenylsulfanyl)pentyl acetate # |
| Molecular Structure | ![]() |
| Molecular Formula | C15H20O3S |
| Molecular Weight | 280.38 |
| CAS Registry Number | 65302-94-5 |
| SMILES | O=C(OCC(=O)C(Sc1ccccc1)C(C)(C)C)C |
| InChI | 1S/C15H20O3S/c1-11(16)18-10-13(17)14(15(2,3)4)19-12-8-6-5-7-9-12/h5-9,14H,10H2,1-4H3 |
| InChIKey | IOYPTRYQWAZAIY-UHFFFAOYSA-N |
| Density | 1.108g/cm3 (Cal.) |
|---|---|
| Boiling point | 371.222°C at 760 mmHg (Cal.) |
| Flash point | 168.714°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,4-Dimethyl-2-oxo-3-(phenylsulfanyl)pentyl acetate |