|
CAS#: 6535-19-9 Product: Manganese Octoate No suppilers available for the product. |
| Name | Manganese Octoate |
|---|---|
| Synonyms | Manganous Octanoate; Manganous Caprylate |
| Molecular Structure | ![]() |
| Molecular Formula | C16H30MnO4 |
| Molecular Weight | 341.35 |
| CAS Registry Number | 6535-19-9 |
| EINECS | 229-437-7 |
| SMILES | C(C([O-])=O)CCCCCC.C(C([O-])=O)CCCCCC.[Mn++] |
| InChI | 1S/2C8H16O2.Mn/c2*1-2-3-4-5-6-7-8(9)10;/h2*2-7H2,1H3,(H,9,10);/q;;+2/p-2 |
| InChIKey | SGLXWMAOOWXVAM-UHFFFAOYSA-L |
| Boiling point | 239.3°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 107.4°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Manganese Octoate |