|
CAS#: 653597-74-1 Product: 3-[(2R,3S)-3-Ethyl-2-oxiranyl]-1H-isochromen-1-one No suppilers available for the product. |
| Name | 3-[(2R,3S)-3-Ethyl-2-oxiranyl]-1H-isochromen-1-one |
|---|---|
| Synonyms | (+)-(S,R)-epoxyartemidin; 3-((2R,3S)-3-ethyloxiran-2-yl)-1H-isochromen-1-one |
| Molecular Structure | ![]() |
| Molecular Formula | C13H12O3 |
| Molecular Weight | 216.23 |
| CAS Registry Number | 653597-74-1 |
| SMILES | CC[C@H]1[C@@H](O1)C2=CC3=CC=CC=C3C(=O)O2 |
| InChI | 1S/C13H12O3/c1-2-10-12(15-10)11-7-8-5-3-4-6-9(8)13(14)16-11/h3-7,10,12H,2H2,1H3/t10-,12+/m0/s1 |
| InChIKey | VNEONZFLGNRQJT-CMPLNLGQSA-N |
| Density | 1.3±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 350.6±42.0°C at 760 mmHg (Cal.) |
| Flash point | 145.8±22.5°C (Cal.) |
| Refractive index | 1.595 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-[(2R,3S)-3-Ethyl-2-oxiranyl]-1H-isochromen-1-one |